C10H17F3N2O2 — CID 92825862
tert-butyl N-[(3S)-3-(trifluoromethyl)pyrrolidin-3-yl]carbamate (PubChem CID 92825862) has the molecular formula C10H17F3N2O2 and a molecular weight of 254.25 g/mol. Its IUPAC name is tert-butyl N-[(3S)-3-(trifluoromethyl)pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-3-(trifluoromethyl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 92825862 |
| Molecular Formula | C10H17F3N2O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | tert-butyl N-[(3S)-3-(trifluoromethyl)pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@]1(C(F)(F)F)CCNC1 |
| InChI | InChI=1S/C10H17F3N2O2/c1-8(2,3)17-7(16)15-9(10(11,12)13)4-5-14-6-9/h14H,4-6H2,1-3H3,(H,15,16)/t9-/m0/s1 |
| InChIKey | CBRWRWRFOZZKCN-VIFPVBQESA-N |
| XLogP | 1.81 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |