C12H22ClFN2O2 — CID 146155252
tert-butyl N-[(3aR,6aS)-3a-fluoro-1,2,3,4,5,6-hexahydrocyclopenta[c]pyrrol-6a-yl]carbamate;hydrochloride (PubChem CID 146155252) has the molecular formula C12H22ClFN2O2 and a molecular weight of 280.77 g/mol. Its IUPAC name is tert-butyl N-[(3aR,6aS)-3a-fluoro-1,2,3,4,5,6-hexahydrocyclopenta[c]pyrrol-6a-yl]carbamate;hydrochloride.
| Compound Name | tert-butyl N-[(3aR,6aS)-3a-fluoro-1,2,3,4,5,6-hexahydrocyclopenta[c]pyrrol-6a-yl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 146155252 |
| Molecular Formula | C12H22ClFN2O2 |
| Molecular Weight | 280.77 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | tert-butyl N-[(3aR,6aS)-3a-fluoro-1,2,3,4,5,6-hexahydrocyclopenta[c]pyrrol-6a-yl]carbamate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)N[C@]12CCC[C@@]1(F)CNC2.Cl |
| InChI | InChI=1S/C12H21FN2O2.ClH/c1-10(2,3)17-9(16)15-12-6-4-5-11(12,13)7-14-8-12;/h14H,4-8H2,1-3H3,(H,15,16);1H/t11-,12+;/m1./s1 |
| InChIKey | PHJXNEDXTLEVAD-LYCTWNKOSA-N |
| XLogP | 2.17 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.77 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |