C12H21ClFNO2 — CID 146155616
tert-butyl (3aS,6aR)-3a-fluoro-1,2,3,4,5,6-hexahydrocyclopenta[c]pyrrole-6a-carboxylate;hydrochloride (PubChem CID 146155616) has the molecular formula C12H21ClFNO2 and a molecular weight of 265.76 g/mol. Its IUPAC name is tert-butyl (3aS,6aR)-3a-fluoro-1,2,3,4,5,6-hexahydrocyclopenta[c]pyrrole-6a-carboxylate;hydrochloride.
| Compound Name | tert-butyl (3aS,6aR)-3a-fluoro-1,2,3,4,5,6-hexahydrocyclopenta[c]pyrrole-6a-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 146155616 |
| Molecular Formula | C12H21ClFNO2 |
| Molecular Weight | 265.76 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | tert-butyl (3aS,6aR)-3a-fluoro-1,2,3,4,5,6-hexahydrocyclopenta[c]pyrrole-6a-carboxylate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)[C@]12CCC[C@@]1(F)CNC2.Cl |
| InChI | InChI=1S/C12H20FNO2.ClH/c1-10(2,3)16-9(15)11-5-4-6-12(11,13)8-14-7-11;/h14H,4-8H2,1-3H3;1H/t11-,12-;/m1./s1 |
| InChIKey | OZOBBZZWQBDOBE-MNMPKAIFSA-N |
| XLogP | 2.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.76 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |