C15H29NO3 — CID 176669976
tert-butyl N-(1-tert-butyl-4-hydroxycyclohexyl)carbamate (PubChem CID 176669976) has the molecular formula C15H29NO3 and a molecular weight of 271.40 g/mol. Its IUPAC name is tert-butyl N-(1-tert-butyl-4-hydroxycyclohexyl)carbamate.
| Compound Name | tert-butyl N-(1-tert-butyl-4-hydroxycyclohexyl)carbamate |
|---|---|
| PubChem CID | 176669976 |
| Molecular Formula | C15H29NO3 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | tert-butyl N-(1-tert-butyl-4-hydroxycyclohexyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(C(C)(C)C)CCC(O)CC1 |
| InChI | InChI=1S/C15H29NO3/c1-13(2,3)15(9-7-11(17)8-10-15)16-12(18)19-14(4,5)6/h11,17H,7-10H2,1-6H3,(H,16,18) |
| InChIKey | HBIIJRVUFNNXMN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |