C13H22N2O4 — CID 67385903
tert-butyl N-[1-[2-(cyclopropylamino)-1-hydroxy-2-oxoethyl]cyclopropyl]carbamate (PubChem CID 67385903) has the molecular formula C13H22N2O4 and a molecular weight of 270.33 g/mol. Its IUPAC name is tert-butyl N-[1-[2-(cyclopropylamino)-1-hydroxy-2-oxoethyl]cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[1-[2-(cyclopropylamino)-1-hydroxy-2-oxoethyl]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 67385903 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | tert-butyl N-[1-[2-(cyclopropylamino)-1-hydroxy-2-oxoethyl]cyclopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(C(O)C(=O)NC2CC2)CC1 |
| InChI | InChI=1S/C13H22N2O4/c1-12(2,3)19-11(18)15-13(6-7-13)9(16)10(17)14-8-4-5-8/h8-9,16H,4-7H2,1-3H3,(H,14,17)(H,15,18) |
| InChIKey | HXYJLIIYLOLTKS-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |