C12H23NO3 — CID 167733960
tert-butyl N-[1-(1-hydroxy-2-methylpropyl)cyclopropyl]carbamate (PubChem CID 167733960) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is tert-butyl N-[1-(1-hydroxy-2-methylpropyl)cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[1-(1-hydroxy-2-methylpropyl)cyclopropyl]carbamate |
|---|---|
| PubChem CID | 167733960 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | tert-butyl N-[1-(1-hydroxy-2-methylpropyl)cyclopropyl]carbamate |
| SMILES | CC(C)C(O)C1(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C12H23NO3/c1-8(2)9(14)12(6-7-12)13-10(15)16-11(3,4)5/h8-9,14H,6-7H2,1-5H3,(H,13,15) |
| InChIKey | CCDHKWQSLJHWDV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |