C9H16N2O2S — CID 58431174
tert-butyl N-(1-carbamothioylcyclopropyl)carbamate (PubChem CID 58431174) has the molecular formula C9H16N2O2S and a molecular weight of 216.31 g/mol. Its IUPAC name is tert-butyl N-(1-carbamothioylcyclopropyl)carbamate.
| Compound Name | tert-butyl N-(1-carbamothioylcyclopropyl)carbamate |
|---|---|
| PubChem CID | 58431174 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | tert-butyl N-(1-carbamothioylcyclopropyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(C(N)=S)CC1 |
| InChI | InChI=1S/C9H16N2O2S/c1-8(2,3)13-7(12)11-9(4-5-9)6(10)14/h4-5H2,1-3H3,(H2,10,14)(H,11,12) |
| InChIKey | GXULZLWFLXCUBB-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|