C11H21N3O4 — CID 138041026
acetic acid;tert-butyl N-(1-carbamimidoylcyclopropyl)carbamate (PubChem CID 138041026) has the molecular formula C11H21N3O4 and a molecular weight of 259.31 g/mol. Its IUPAC name is acetic acid;tert-butyl N-(1-carbamimidoylcyclopropyl)carbamate.
| Compound Name | acetic acid;tert-butyl N-(1-carbamimidoylcyclopropyl)carbamate |
|---|---|
| PubChem CID | 138041026 |
| Molecular Formula | C11H21N3O4 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | acetic acid;tert-butyl N-(1-carbamimidoylcyclopropyl)carbamate |
| SMILES | CC(=O)O.[H]/N=C(\N)C1(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C9H17N3O2.C2H4O2/c1-8(2,3)14-7(13)12-9(4-5-9)6(10)11;1-2(3)4/h4-5H2,1-3H3,(H3,10,11)(H,12,13);1H3,(H,3,4) |
| InChIKey | DDGJESFTANTDIS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 125.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|