C18H32N2O3 — CID 91256429
tert-butyl N-[1-[1-(cyclopropylamino)-1-oxobutan-2-yl]-3-ethylcyclobutyl]carbamate (PubChem CID 91256429) has the molecular formula C18H32N2O3 and a molecular weight of 324.47 g/mol. Its IUPAC name is tert-butyl N-[1-[1-(cyclopropylamino)-1-oxobutan-2-yl]-3-ethylcyclobutyl]carbamate.
| Compound Name | tert-butyl N-[1-[1-(cyclopropylamino)-1-oxobutan-2-yl]-3-ethylcyclobutyl]carbamate |
|---|---|
| PubChem CID | 91256429 |
| Molecular Formula | C18H32N2O3 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.24 |
| IUPAC Name | tert-butyl N-[1-[1-(cyclopropylamino)-1-oxobutan-2-yl]-3-ethylcyclobutyl]carbamate |
| SMILES | CCC1CC(NC(=O)OC(C)(C)C)(C(CC)C(=O)NC2CC2)C1 |
| InChI | InChI=1S/C18H32N2O3/c1-6-12-10-18(11-12,20-16(22)23-17(3,4)5)14(7-2)15(21)19-13-8-9-13/h12-14H,6-11H2,1-5H3,(H,19,21)(H,20,22) |
| InChIKey | CQAXPMXZVNXJPK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |