C11H23N2O2+ — CID 7021549
[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]azanium (PubChem CID 7021549) has the molecular formula C11H23N2O2+ and a molecular weight of 215.32 g/mol. Its IUPAC name is [4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]azanium.
| Compound Name | [4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]azanium |
|---|---|
| PubChem CID | 7021549 |
| Molecular Formula | C11H23N2O2+ |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.18 |
| IUPAC Name | [4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]azanium |
| SMILES | CC(C)(C)OC(=O)NC1CCC([NH3+])CC1 |
| InChI | InChI=1S/C11H22N2O2/c1-11(2,3)15-10(14)13-9-6-4-8(12)5-7-9/h8-9H,4-7,12H2,1-3H3,(H,13,14)/p+1 |
| InChIKey | FEYLUKDSKVSMSZ-UHFFFAOYSA-O |
| XLogP | 1.06 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |