C12H22N2O2 — CID 138714983
tert-butyl N-[4-(methylideneamino)cyclohexyl]carbamate (PubChem CID 138714983) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is tert-butyl N-[4-(methylideneamino)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-(methylideneamino)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 138714983 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | tert-butyl N-[4-(methylideneamino)cyclohexyl]carbamate |
| SMILES | C=NC1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C12H22N2O2/c1-12(2,3)16-11(15)14-10-7-5-9(13-4)6-8-10/h9-10H,4-8H2,1-3H3,(H,14,15) |
| InChIKey | VQJXHACVYXZUDO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|