C16H29NO3 — CID 59470733
tert-butyl N-[4-(2,2-dimethylpropanoyl)cyclohexyl]carbamate (PubChem CID 59470733) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is tert-butyl N-[4-(2,2-dimethylpropanoyl)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-(2,2-dimethylpropanoyl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 59470733 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | tert-butyl N-[4-(2,2-dimethylpropanoyl)cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(C(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C16H29NO3/c1-15(2,3)13(18)11-7-9-12(10-8-11)17-14(19)20-16(4,5)6/h11-12H,7-10H2,1-6H3,(H,17,19) |
| InChIKey | LCOVMQICEHVOEE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |