C12H26N2O3 — CID 144612195
tert-butyl N-(4-hydroxypiperidin-1-yl)carbamate;ethane (PubChem CID 144612195) has the molecular formula C12H26N2O3 and a molecular weight of 246.35 g/mol. Its IUPAC name is tert-butyl N-(4-hydroxypiperidin-1-yl)carbamate;ethane.
| Compound Name | tert-butyl N-(4-hydroxypiperidin-1-yl)carbamate;ethane |
|---|---|
| PubChem CID | 144612195 |
| Molecular Formula | C12H26N2O3 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | tert-butyl N-(4-hydroxypiperidin-1-yl)carbamate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)NN1CCC(O)CC1 |
| InChI | InChI=1S/C10H20N2O3.C2H6/c1-10(2,3)15-9(14)11-12-6-4-8(13)5-7-12;1-2/h8,13H,4-7H2,1-3H3,(H,11,14);1-2H3 |
| InChIKey | KFNZMFMJCCOLSW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |