C10H21N3O3 — CID 59857801
tert-butyl N-(4-methoxypiperazin-1-yl)carbamate (PubChem CID 59857801) has the molecular formula C10H21N3O3 and a molecular weight of 231.30 g/mol. Its IUPAC name is tert-butyl N-(4-methoxypiperazin-1-yl)carbamate.
| Compound Name | tert-butyl N-(4-methoxypiperazin-1-yl)carbamate |
|---|---|
| PubChem CID | 59857801 |
| Molecular Formula | C10H21N3O3 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | tert-butyl N-(4-methoxypiperazin-1-yl)carbamate |
| SMILES | CON1CCN(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C10H21N3O3/c1-10(2,3)16-9(14)11-12-5-7-13(15-4)8-6-12/h5-8H2,1-4H3,(H,11,14) |
| InChIKey | JHXCFNCDUSREMB-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |