C11H23N3O3Si — CID 14278942
tert-butyl N-(2-oxo-3-trimethylsilylimidazolidin-1-yl)carbamate (PubChem CID 14278942) has the molecular formula C11H23N3O3Si and a molecular weight of 273.41 g/mol. Its IUPAC name is tert-butyl N-(2-oxo-3-trimethylsilylimidazolidin-1-yl)carbamate.
| Compound Name | tert-butyl N-(2-oxo-3-trimethylsilylimidazolidin-1-yl)carbamate |
|---|---|
| PubChem CID | 14278942 |
| Molecular Formula | C11H23N3O3Si |
| Molecular Weight | 273.41 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | tert-butyl N-(2-oxo-3-trimethylsilylimidazolidin-1-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NN1CCN([Si](C)(C)C)C1=O |
| InChI | InChI=1S/C11H23N3O3Si/c1-11(2,3)17-9(15)12-13-7-8-14(10(13)16)18(4,5)6/h7-8H2,1-6H3,(H,12,15) |
| InChIKey | YVNQNXXDDSZUPR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|