C9H14N2O4 — CID 162373517
tert-butyl N-(3-hydroxy-5-oxo-2H-pyrrol-1-yl)carbamate (PubChem CID 162373517) has the molecular formula C9H14N2O4 and a molecular weight of 214.22 g/mol. Its IUPAC name is tert-butyl N-(3-hydroxy-5-oxo-2H-pyrrol-1-yl)carbamate.
| Compound Name | tert-butyl N-(3-hydroxy-5-oxo-2H-pyrrol-1-yl)carbamate |
|---|---|
| PubChem CID | 162373517 |
| Molecular Formula | C9H14N2O4 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | tert-butyl N-(3-hydroxy-5-oxo-2H-pyrrol-1-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NN1CC(O)=CC1=O |
| InChI | InChI=1S/C9H14N2O4/c1-9(2,3)15-8(14)10-11-5-6(12)4-7(11)13/h4,12H,5H2,1-3H3,(H,10,14) |
| InChIKey | FBWQWSJUWYDEKN-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |