C14H20N2O2 — CID 150205749
tert-butyl N-(3,4-dihydro-2H-quinolin-1-yl)carbamate (PubChem CID 150205749) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is tert-butyl N-(3,4-dihydro-2H-quinolin-1-yl)carbamate.
| Compound Name | tert-butyl N-(3,4-dihydro-2H-quinolin-1-yl)carbamate |
|---|---|
| PubChem CID | 150205749 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | tert-butyl N-(3,4-dihydro-2H-quinolin-1-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NN1CCCc2ccccc21 |
| InChI | InChI=1S/C14H20N2O2/c1-14(2,3)18-13(17)15-16-10-6-8-11-7-4-5-9-12(11)16/h4-5,7,9H,6,8,10H2,1-3H3,(H,15,17) |
| InChIKey | FQLJEARHJJOHBT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |