C10H13N3O — CID 19747645
3,4-dihydro-2H-quinolin-1-ylurea (PubChem CID 19747645) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 3,4-dihydro-2H-quinolin-1-ylurea.
| Compound Name | 3,4-dihydro-2H-quinolin-1-ylurea |
|---|---|
| PubChem CID | 19747645 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 3,4-dihydro-2H-quinolin-1-ylurea |
| SMILES | NC(=O)NN1CCCc2ccccc21 |
| InChI | InChI=1S/C10H13N3O/c11-10(14)12-13-7-3-5-8-4-1-2-6-9(8)13/h1-2,4,6H,3,5,7H2,(H3,11,12,14) |
| InChIKey | CYFSDBDAECVIBK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |