C10H12N2O2 — CID 67189387
3,4-dihydro-2H-quinolin-1-ylcarbamic acid (PubChem CID 67189387) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 3,4-dihydro-2H-quinolin-1-ylcarbamic acid.
| Compound Name | 3,4-dihydro-2H-quinolin-1-ylcarbamic acid |
|---|---|
| PubChem CID | 67189387 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 3,4-dihydro-2H-quinolin-1-ylcarbamic acid |
| SMILES | O=C(O)NN1CCCc2ccccc21 |
| InChI | InChI=1S/C10H12N2O2/c13-10(14)11-12-7-3-5-8-4-1-2-6-9(8)12/h1-2,4,6,11H,3,5,7H2,(H,13,14) |
| InChIKey | KHPQNSBWUUIZBI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |