C9H11N3O — CID 22353227
2,3-dihydroindol-1-ylurea (PubChem CID 22353227) has the molecular formula C9H11N3O and a molecular weight of 177.21 g/mol. Its IUPAC name is 2,3-dihydroindol-1-ylurea.
| Compound Name | 2,3-dihydroindol-1-ylurea |
|---|---|
| PubChem CID | 22353227 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 2,3-dihydroindol-1-ylurea |
| SMILES | NC(=O)NN1CCc2ccccc21 |
| InChI | InChI=1S/C9H11N3O/c10-9(13)11-12-6-5-7-3-1-2-4-8(7)12/h1-4H,5-6H2,(H3,10,11,13) |
| InChIKey | LXTAUDGSYVKINH-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |