C12H16N2O2S — CID 87347076
2,3-dihydroindole-1-carbothioic S-acid;propanamide (PubChem CID 87347076) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 2,3-dihydroindole-1-carbothioic S-acid;propanamide.
| Compound Name | 2,3-dihydroindole-1-carbothioic S-acid;propanamide |
|---|---|
| PubChem CID | 87347076 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 2,3-dihydroindole-1-carbothioic S-acid;propanamide |
| SMILES | CCC(N)=O.O=C(S)N1CCc2ccccc21 |
| InChI | InChI=1S/C9H9NOS.C3H7NO/c11-9(12)10-6-5-7-3-1-2-4-8(7)10;1-2-3(4)5/h1-4H,5-6H2,(H,11,12);2H2,1H3,(H2,4,5) |
| InChIKey | SRTRZWSKLBTBNI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|