C19H29NO — CID 4052782
1-(2,3-dihydroindol-1-yl)undecan-1-one (PubChem CID 4052782) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is 1-(2,3-dihydroindol-1-yl)undecan-1-one.
| Compound Name | 1-(2,3-dihydroindol-1-yl)undecan-1-one |
|---|---|
| PubChem CID | 4052782 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 1-(2,3-dihydroindol-1-yl)undecan-1-one |
| SMILES | CCCCCCCCCCC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C19H29NO/c1-2-3-4-5-6-7-8-9-14-19(21)20-16-15-17-12-10-11-13-18(17)20/h10-13H,2-9,14-16H2,1H3 |
| InChIKey | ATIPWJVTCNPFAZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|