C15H23N2O+ — CID 2443776
[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-pentylazanium (PubChem CID 2443776) has the molecular formula C15H23N2O+ and a molecular weight of 247.36 g/mol. Its IUPAC name is [2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-pentylazanium.
| Compound Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-pentylazanium |
|---|---|
| PubChem CID | 2443776 |
| Molecular Formula | C15H23N2O+ |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-pentylazanium |
| SMILES | CCCCC[NH2+]CC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C15H22N2O/c1-2-3-6-10-16-12-15(18)17-11-9-13-7-4-5-8-14(13)17/h4-5,7-8,16H,2-3,6,9-12H2,1H3/p+1 |
| InChIKey | KGYJZNBGAAAZGR-UHFFFAOYSA-O |
| XLogP | 1.33 |
| TPSA | 36.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|