C16H24N2O3S — CID 113153451
N-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-N-pentylmethanesulfonamide (PubChem CID 113153451) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is N-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-N-pentylmethanesulfonamide.
| Compound Name | N-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-N-pentylmethanesulfonamide |
|---|---|
| PubChem CID | 113153451 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | N-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-N-pentylmethanesulfonamide |
| SMILES | CCCCCN(CC(=O)N1CCc2ccccc21)S(C)(=O)=O |
| InChI | InChI=1S/C16H24N2O3S/c1-3-4-7-11-17(22(2,20)21)13-16(19)18-12-10-14-8-5-6-9-15(14)18/h5-6,8-9H,3-4,7,10-13H2,1-2H3 |
| InChIKey | VCPWTPVNMMAVFT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|