C17H25NO — CID 3742272
1-(2,3-dihydroindol-1-yl)nonan-1-one (PubChem CID 3742272) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 1-(2,3-dihydroindol-1-yl)nonan-1-one.
| Compound Name | 1-(2,3-dihydroindol-1-yl)nonan-1-one |
|---|---|
| PubChem CID | 3742272 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 1-(2,3-dihydroindol-1-yl)nonan-1-one |
| SMILES | CCCCCCCCC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C17H25NO/c1-2-3-4-5-6-7-12-17(19)18-14-13-15-10-8-9-11-16(15)18/h8-11H,2-7,12-14H2,1H3 |
| InChIKey | FGCSNECBHGEKEE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|