C14H25N — CID 91236662
ethane;1-methyl-3,4-dihydro-2H-quinoline (PubChem CID 91236662) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is ethane;1-methyl-3,4-dihydro-2H-quinoline.
| Compound Name | ethane;1-methyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 91236662 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | ethane;1-methyl-3,4-dihydro-2H-quinoline |
| SMILES | CC.CC.CN1CCCc2ccccc21 |
| InChI | InChI=1S/C10H13N.2C2H6/c1-11-8-4-6-9-5-2-3-7-10(9)11;2*1-2/h2-3,5,7H,4,6,8H2,1H3;2*1-2H3 |
| InChIKey | PSADCFPBFFPVSO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |