C15H25N — CID 170597916
ethane;1-(2-methylpropyl)-3,4-dihydro-2H-quinoline (PubChem CID 170597916) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is ethane;1-(2-methylpropyl)-3,4-dihydro-2H-quinoline.
| Compound Name | ethane;1-(2-methylpropyl)-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 170597916 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | ethane;1-(2-methylpropyl)-3,4-dihydro-2H-quinoline |
| SMILES | CC.CC(C)CN1CCCc2ccccc21 |
| InChI | InChI=1S/C13H19N.C2H6/c1-11(2)10-14-9-5-7-12-6-3-4-8-13(12)14;1-2/h3-4,6,8,11H,5,7,9-10H2,1-2H3;1-2H3 |
| InChIKey | HQTBBBKHGSPROA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |