C30H44N2O2 — CID 92532372
(2S,11R)-1,12-bis(3,4-dihydro-2H-quinolin-1-yl)dodecane-2,11-diol (PubChem CID 92532372) has the molecular formula C30H44N2O2 and a molecular weight of 464.69 g/mol. Its IUPAC name is (2S,11R)-1,12-bis(3,4-dihydro-2H-quinolin-1-yl)dodecane-2,11-diol.
| Compound Name | (2S,11R)-1,12-bis(3,4-dihydro-2H-quinolin-1-yl)dodecane-2,11-diol |
|---|---|
| PubChem CID | 92532372 |
| Molecular Formula | C30H44N2O2 |
| Molecular Weight | 464.69 g/mol |
| Exact Mass | 464.34 |
| IUPAC Name | (2S,11R)-1,12-bis(3,4-dihydro-2H-quinolin-1-yl)dodecane-2,11-diol |
| SMILES | O[C@H](CCCCCCCC[C@H](O)CN1CCCc2ccccc21)CN1CCCc2ccccc21 |
| InChI | InChI=1S/C30H44N2O2/c33-27(23-31-21-11-15-25-13-7-9-19-29(25)31)17-5-3-1-2-4-6-18-28(34)24-32-22-12-16-26-14-8-10-20-30(26)32/h7-10,13-14,19-20,27-28,33-34H,1-6,11-12,15-18,21-24H2/t27-,28+ |
| InChIKey | XOXPFFAFFWPKJZ-HNRBIFIRSA-N |
| XLogP | 5.73 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.69 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|