C19H23NO2 — CID 3804893
1-(3,4-dihydro-2H-quinolin-1-yl)-3-phenylmethoxypropan-2-ol (PubChem CID 3804893) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-quinolin-1-yl)-3-phenylmethoxypropan-2-ol.
| Compound Name | 1-(3,4-dihydro-2H-quinolin-1-yl)-3-phenylmethoxypropan-2-ol |
|---|---|
| PubChem CID | 3804893 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 1-(3,4-dihydro-2H-quinolin-1-yl)-3-phenylmethoxypropan-2-ol |
| SMILES | OC(COCc1ccccc1)CN1CCCc2ccccc21 |
| InChI | InChI=1S/C19H23NO2/c21-18(15-22-14-16-7-2-1-3-8-16)13-20-12-6-10-17-9-4-5-11-19(17)20/h1-5,7-9,11,18,21H,6,10,12-15H2 |
| InChIKey | JZILYORZOSMKBH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |