C20H33NO2 — CID 143232672
1-(3,4-dihydro-2H-quinolin-1-yl)-3-(2-ethylhexoxy)propan-2-ol (PubChem CID 143232672) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-quinolin-1-yl)-3-(2-ethylhexoxy)propan-2-ol.
| Compound Name | 1-(3,4-dihydro-2H-quinolin-1-yl)-3-(2-ethylhexoxy)propan-2-ol |
|---|---|
| PubChem CID | 143232672 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | 1-(3,4-dihydro-2H-quinolin-1-yl)-3-(2-ethylhexoxy)propan-2-ol |
| SMILES | CCCCC(CC)COCC(O)CN1CCCc2ccccc21 |
| InChI | InChI=1S/C20H33NO2/c1-3-5-9-17(4-2)15-23-16-19(22)14-21-13-8-11-18-10-6-7-12-20(18)21/h6-7,10,12,17,19,22H,3-5,8-9,11,13-16H2,1-2H3 |
| InChIKey | FEJUYVLTONUTPO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |