C17H25NO2 — CID 54416259
2-ethylhexyl 2,3-dihydroindole-1-carboxylate (PubChem CID 54416259) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 2-ethylhexyl 2,3-dihydroindole-1-carboxylate.
| Compound Name | 2-ethylhexyl 2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 54416259 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 2-ethylhexyl 2,3-dihydroindole-1-carboxylate |
| SMILES | CCCCC(CC)COC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C17H25NO2/c1-3-5-8-14(4-2)13-20-17(19)18-12-11-15-9-6-7-10-16(15)18/h6-7,9-10,14H,3-5,8,11-13H2,1-2H3 |
| InChIKey | VXQLUZLSSJAXBK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |