2-ethylhexyl 2,3-dihydroindole-1-carboxylate

C17H25NO2 — CID 54416259

IUPAC2-ethylhexyl 2,3-dihydroindole-1-carboxylate
SMILESCCCCC(CC)COC(=O)N1CCc2ccccc21
InChIInChI=1S/C17H25NO2/c1-3-5-8-14(4-2)13-20-17(19)18-12-11-15-9-6-7-10-16(15)18/h6-7,9-10,14H,3-5,8,11-13H2,1-2H3
InChIKeyVXQLUZLSSJAXBK-UHFFFAOYSA-N
MW275.39 g/mol
LogP4.40
Rot. Bonds6

About 2-ethylhexyl 2,3-dihydroindole-1-carboxylate

2-ethylhexyl 2,3-dihydroindole-1-carboxylate (PubChem CID 54416259) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 2-ethylhexyl 2,3-dihydroindole-1-carboxylate.

Molecular Properties

Compound Name2-ethylhexyl 2,3-dihydroindole-1-carboxylate
PubChem CID54416259
Molecular FormulaC17H25NO2
Molecular Weight275.39 g/mol
Exact Mass275.19
IUPAC Name2-ethylhexyl 2,3-dihydroindole-1-carboxylate
SMILESCCCCC(CC)COC(=O)N1CCc2ccccc21
InChIInChI=1S/C17H25NO2/c1-3-5-8-14(4-2)13-20-17(19)18-12-11-15-9-6-7-10-16(15)18/h6-7,9-10,14H,3-5,8,11-13H2,1-2H3
InChIKeyVXQLUZLSSJAXBK-UHFFFAOYSA-N
XLogP4.40
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.39
LogP ≤ 54.40
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 2-ethylhexyl 2,3-dihydroindole-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethylhexyl 2,3-dihydroindole-1-carboxylate?
The IUPAC name of 2-ethylhexyl 2,3-dihydroindole-1-carboxylate (CID 54416259) is 2-ethylhexyl 2,3-dihydroindole-1-carboxylate.
What is the SMILES notation for 2-ethylhexyl 2,3-dihydroindole-1-carboxylate?
The canonical SMILES for 2-ethylhexyl 2,3-dihydroindole-1-carboxylate is CCCCC(CC)COC(=O)N1CCc2ccccc21.
What is the InChIKey of 2-ethylhexyl 2,3-dihydroindole-1-carboxylate?
The InChIKey is VXQLUZLSSJAXBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO2/c1-3-5-8-14(4-2)13-20-17(19)18-12-11-15-9-6-7-10-16(15)18/h6-7,9-10,14H,3-5,8,11-13H2,1-2H3.
What are the key properties of 2-ethylhexyl 2,3-dihydroindole-1-carboxylate?
2-ethylhexyl 2,3-dihydroindole-1-carboxylate has a molecular weight of 275.39 g/mol, XLogP of 4.40, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl 2,3-dihydroindole-1-carboxylate is sourced from PubChem (CID 54416259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).