C13H20N2O — CID 64820971
1-amino-4-(3,4-dihydro-2H-quinolin-1-yl)butan-2-ol (PubChem CID 64820971) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 1-amino-4-(3,4-dihydro-2H-quinolin-1-yl)butan-2-ol.
| Compound Name | 1-amino-4-(3,4-dihydro-2H-quinolin-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 64820971 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 1-amino-4-(3,4-dihydro-2H-quinolin-1-yl)butan-2-ol |
| SMILES | NCC(O)CCN1CCCc2ccccc21 |
| InChI | InChI=1S/C13H20N2O/c14-10-12(16)7-9-15-8-3-5-11-4-1-2-6-13(11)15/h1-2,4,6,12,16H,3,5,7-10,14H2 |
| InChIKey | RPDYEGKHDSXRSV-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |