C13H17N3 — CID 63028093
2-amino-4-(3,4-dihydro-2H-quinolin-1-yl)butanenitrile (PubChem CID 63028093) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 2-amino-4-(3,4-dihydro-2H-quinolin-1-yl)butanenitrile.
| Compound Name | 2-amino-4-(3,4-dihydro-2H-quinolin-1-yl)butanenitrile |
|---|---|
| PubChem CID | 63028093 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 2-amino-4-(3,4-dihydro-2H-quinolin-1-yl)butanenitrile |
| SMILES | N#CC(N)CCN1CCCc2ccccc21 |
| InChI | InChI=1S/C13H17N3/c14-10-12(15)7-9-16-8-3-5-11-4-1-2-6-13(11)16/h1-2,4,6,12H,3,5,7-9,15H2 |
| InChIKey | LDVBAOQVBHJOBA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |