C15H24N2 — CID 66454044
4-(3,4-dihydro-2H-quinolin-1-yl)-3,3-dimethylbutan-2-amine (PubChem CID 66454044) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-quinolin-1-yl)-3,3-dimethylbutan-2-amine.
| Compound Name | 4-(3,4-dihydro-2H-quinolin-1-yl)-3,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 66454044 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 4-(3,4-dihydro-2H-quinolin-1-yl)-3,3-dimethylbutan-2-amine |
| SMILES | CC(N)C(C)(C)CN1CCCc2ccccc21 |
| InChI | InChI=1S/C15H24N2/c1-12(16)15(2,3)11-17-10-6-8-13-7-4-5-9-14(13)17/h4-5,7,9,12H,6,8,10-11,16H2,1-3H3 |
| InChIKey | WYAZPXWSIOEDAR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |