C15H21N — CID 82078705
1-(cyclopentylmethyl)-3,4-dihydro-2H-quinoline (PubChem CID 82078705) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is 1-(cyclopentylmethyl)-3,4-dihydro-2H-quinoline.
| Compound Name | 1-(cyclopentylmethyl)-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 82078705 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 1-(cyclopentylmethyl)-3,4-dihydro-2H-quinoline |
| SMILES | c1ccc2c(c1)CCCN2CC1CCCC1 |
| InChI | InChI=1S/C15H21N/c1-2-7-13(6-1)12-16-11-5-9-14-8-3-4-10-15(14)16/h3-4,8,10,13H,1-2,5-7,9,11-12H2 |
| InChIKey | HXDJUSFUVRNXCN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |