C14H20N2S — CID 82917784
3-(3,4-dihydro-2H-quinolin-1-ylmethyl)thiomorpholine (PubChem CID 82917784) has the molecular formula C14H20N2S and a molecular weight of 248.39 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-quinolin-1-ylmethyl)thiomorpholine.
| Compound Name | 3-(3,4-dihydro-2H-quinolin-1-ylmethyl)thiomorpholine |
|---|---|
| PubChem CID | 82917784 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 3-(3,4-dihydro-2H-quinolin-1-ylmethyl)thiomorpholine |
| SMILES | c1ccc2c(c1)CCCN2CC1CSCCN1 |
| InChI | InChI=1S/C14H20N2S/c1-2-6-14-12(4-1)5-3-8-16(14)10-13-11-17-9-7-15-13/h1-2,4,6,13,15H,3,5,7-11H2 |
| InChIKey | AFCGYNHWFLTEBT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |