C16H22N2O — CID 115006940
2-(3,4-dihydro-2H-quinolin-1-yl)-1-piperidin-2-ylethanone (PubChem CID 115006940) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-quinolin-1-yl)-1-piperidin-2-ylethanone.
| Compound Name | 2-(3,4-dihydro-2H-quinolin-1-yl)-1-piperidin-2-ylethanone |
|---|---|
| PubChem CID | 115006940 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 2-(3,4-dihydro-2H-quinolin-1-yl)-1-piperidin-2-ylethanone |
| SMILES | O=C(CN1CCCc2ccccc21)C1CCCCN1 |
| InChI | InChI=1S/C16H22N2O/c19-16(14-8-3-4-10-17-14)12-18-11-5-7-13-6-1-2-9-15(13)18/h1-2,6,9,14,17H,3-5,7-8,10-12H2 |
| InChIKey | PKNCHBMFMBXSKV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |