C11H12FNO2 — CID 145056467
fluoro 2-(3,4-dihydro-2H-quinolin-1-yl)acetate (PubChem CID 145056467) has the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. Its IUPAC name is fluoro 2-(3,4-dihydro-2H-quinolin-1-yl)acetate.
| Compound Name | fluoro 2-(3,4-dihydro-2H-quinolin-1-yl)acetate |
|---|---|
| PubChem CID | 145056467 |
| Molecular Formula | C11H12FNO2 |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | fluoro 2-(3,4-dihydro-2H-quinolin-1-yl)acetate |
| SMILES | O=C(CN1CCCc2ccccc21)OF |
| InChI | InChI=1S/C11H12FNO2/c12-15-11(14)8-13-7-3-5-9-4-1-2-6-10(9)13/h1-2,4,6H,3,5,7-8H2 |
| InChIKey | XKMDOHQZTVOETE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |