C13H17NO2 — CID 107507115
1-(3,4-dihydro-2H-quinolin-1-yl)-3-methoxypropan-2-one (PubChem CID 107507115) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-quinolin-1-yl)-3-methoxypropan-2-one.
| Compound Name | 1-(3,4-dihydro-2H-quinolin-1-yl)-3-methoxypropan-2-one |
|---|---|
| PubChem CID | 107507115 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 1-(3,4-dihydro-2H-quinolin-1-yl)-3-methoxypropan-2-one |
| SMILES | COCC(=O)CN1CCCc2ccccc21 |
| InChI | InChI=1S/C13H17NO2/c1-16-10-12(15)9-14-8-4-6-11-5-2-3-7-13(11)14/h2-3,5,7H,4,6,8-10H2,1H3 |
| InChIKey | WFCSHZKCTDQUJK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |