About 3-(3,4-dihydro-2H-quinolin-1-yl)prop-1-en-2-yl-trifluoroboranuide
3-(3,4-dihydro-2H-quinolin-1-yl)prop-1-en-2-yl-trifluoroboranuide (PubChem CID 106745635) has the molecular formula C12H14BF3N-
and a molecular weight of 240.06 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-quinolin-1-yl)prop-1-en-2-yl-trifluoroboranuide.
Molecular Properties
| Compound Name | 3-(3,4-dihydro-2H-quinolin-1-yl)prop-1-en-2-yl-trifluoroboranuide |
| PubChem CID | 106745635 |
| Molecular Formula | C12H14BF3N- |
| Molecular Weight | 240.06 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 3-(3,4-dihydro-2H-quinolin-1-yl)prop-1-en-2-yl-trifluoroboranuide |
| SMILES | C=C(CN1CCCc2ccccc21)[B-](F)(F)F |
| InChI | InChI=1S/C12H14BF3N/c1-10(13(14,15)16)9-17-8-4-6-11-5-2-3-7-12(11)17/h2-3,5,7H,1,4,6,8-9H2/q-1 |
| InChIKey | LHPPIKTWWIWTNA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.06 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-dihydro-2H-quinolin-1-yl)prop-1-en-2-yl-trifluoroboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dihydro-2H-quinolin-1-yl)prop-1-en-2-yl-trifluoroboranuide?
The IUPAC name of 3-(3,4-dihydro-2H-quinolin-1-yl)prop-1-en-2-yl-trifluoroboranuide (CID 106745635) is 3-(3,4-dihydro-2H-quinolin-1-yl)prop-1-en-2-yl-trifluoroboranuide.
What is the SMILES notation for 3-(3,4-dihydro-2H-quinolin-1-yl)prop-1-en-2-yl-trifluoroboranuide?
The canonical SMILES for 3-(3,4-dihydro-2H-quinolin-1-yl)prop-1-en-2-yl-trifluoroboranuide is C=C(CN1CCCc2ccccc21)[B-](F)(F)F.
What is the InChIKey of 3-(3,4-dihydro-2H-quinolin-1-yl)prop-1-en-2-yl-trifluoroboranuide?
The InChIKey is LHPPIKTWWIWTNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BF3N/c1-10(13(14,15)16)9-17-8-4-6-11-5-2-3-7-12(11)17/h2-3,5,7H,1,4,6,8-9H2/q-1.
What are the key properties of 3-(3,4-dihydro-2H-quinolin-1-yl)prop-1-en-2-yl-trifluoroboranuide?
3-(3,4-dihydro-2H-quinolin-1-yl)prop-1-en-2-yl-trifluoroboranuide has a molecular weight of 240.06 g/mol, XLogP of 3.38, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dihydro-2H-quinolin-1-yl)prop-1-en-2-yl-trifluoroboranuide is sourced from PubChem (CID 106745635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).