About potassium trifluoro-[3-(4-methyl-2,3-dihydroquinoxalin-1-yl)prop-1-en-2-yl]boranuide
potassium trifluoro-[3-(4-methyl-2,3-dihydroquinoxalin-1-yl)prop-1-en-2-yl]boranuide (PubChem CID 106746087) has the molecular formula C12H15BF3KN2
and a molecular weight of 294.17 g/mol. Its IUPAC name is potassium trifluoro-[3-(4-methyl-2,3-dihydroquinoxalin-1-yl)prop-1-en-2-yl]boranuide.
Molecular Properties
| Compound Name | potassium trifluoro-[3-(4-methyl-2,3-dihydroquinoxalin-1-yl)prop-1-en-2-yl]boranuide |
| PubChem CID | 106746087 |
| Molecular Formula | C12H15BF3KN2 |
| Molecular Weight | 294.17 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | potassium trifluoro-[3-(4-methyl-2,3-dihydroquinoxalin-1-yl)prop-1-en-2-yl]boranuide |
| SMILES | C=C(CN1CCN(C)c2ccccc21)[B-](F)(F)F.[K+] |
| InChI | InChI=1S/C12H15BF3N2.K/c1-10(13(14,15)16)9-18-8-7-17(2)11-5-3-4-6-12(11)18;/h3-6H,1,7-9H2,2H3;/q-1;+1 |
| InChIKey | NSAXOZZGDRBAIO-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.17 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze potassium trifluoro-[3-(4-methyl-2,3-dihydroquinoxalin-1-yl)prop-1-en-2-yl]boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium trifluoro-[3-(4-methyl-2,3-dihydroquinoxalin-1-yl)prop-1-en-2-yl]boranuide?
The IUPAC name of potassium trifluoro-[3-(4-methyl-2,3-dihydroquinoxalin-1-yl)prop-1-en-2-yl]boranuide (CID 106746087) is potassium trifluoro-[3-(4-methyl-2,3-dihydroquinoxalin-1-yl)prop-1-en-2-yl]boranuide.
What is the SMILES notation for potassium trifluoro-[3-(4-methyl-2,3-dihydroquinoxalin-1-yl)prop-1-en-2-yl]boranuide?
The canonical SMILES for potassium trifluoro-[3-(4-methyl-2,3-dihydroquinoxalin-1-yl)prop-1-en-2-yl]boranuide is C=C(CN1CCN(C)c2ccccc21)[B-](F)(F)F.[K+].
What is the InChIKey of potassium trifluoro-[3-(4-methyl-2,3-dihydroquinoxalin-1-yl)prop-1-en-2-yl]boranuide?
The InChIKey is NSAXOZZGDRBAIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BF3N2.K/c1-10(13(14,15)16)9-18-8-7-17(2)11-5-3-4-6-12(11)18;/h3-6H,1,7-9H2,2H3;/q-1;+1.
What are the key properties of potassium trifluoro-[3-(4-methyl-2,3-dihydroquinoxalin-1-yl)prop-1-en-2-yl]boranuide?
potassium trifluoro-[3-(4-methyl-2,3-dihydroquinoxalin-1-yl)prop-1-en-2-yl]boranuide has a molecular weight of 294.17 g/mol, XLogP of -0.11, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium trifluoro-[3-(4-methyl-2,3-dihydroquinoxalin-1-yl)prop-1-en-2-yl]boranuide is sourced from PubChem (CID 106746087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).