C13H16BF3N- — CID 106746118
trifluoro-[3-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)prop-1-en-2-yl]boranuide (PubChem CID 106746118) has the molecular formula C13H16BF3N- and a molecular weight of 254.08 g/mol. Its IUPAC name is trifluoro-[3-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)prop-1-en-2-yl]boranuide.
| Compound Name | trifluoro-[3-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)prop-1-en-2-yl]boranuide |
|---|---|
| PubChem CID | 106746118 |
| Molecular Formula | C13H16BF3N- |
| Molecular Weight | 254.08 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | trifluoro-[3-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)prop-1-en-2-yl]boranuide |
| SMILES | C=C(CN1CCc2ccccc2CC1)[B-](F)(F)F |
| InChI | InChI=1S/C13H16BF3N/c1-11(14(15,16)17)10-18-8-6-12-4-2-3-5-13(12)7-9-18/h2-5H,1,6-10H2/q-1 |
| InChIKey | XUNWWSLXXUHGNX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.08 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|