C8H14BF3KNO — CID 106746009
potassium trifluoro-[3-(1,4-oxazepan-4-yl)prop-1-en-2-yl]boranuide (PubChem CID 106746009) has the molecular formula C8H14BF3KNO and a molecular weight of 247.11 g/mol. Its IUPAC name is potassium trifluoro-[3-(1,4-oxazepan-4-yl)prop-1-en-2-yl]boranuide.
| Compound Name | potassium trifluoro-[3-(1,4-oxazepan-4-yl)prop-1-en-2-yl]boranuide |
|---|---|
| PubChem CID | 106746009 |
| Molecular Formula | C8H14BF3KNO |
| Molecular Weight | 247.11 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | potassium trifluoro-[3-(1,4-oxazepan-4-yl)prop-1-en-2-yl]boranuide |
| SMILES | C=C(CN1CCCOCC1)[B-](F)(F)F.[K+] |
| InChI | InChI=1S/C8H14BF3NO.K/c1-8(9(10,11)12)7-13-3-2-5-14-6-4-13;/h1-7H2;/q-1;+1 |
| InChIKey | QFYRDLGSAGKFPW-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.11 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|