C9H16BF3KNO — CID 106746265
potassium 3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]prop-1-en-2-yl-trifluoroboranuide (PubChem CID 106746265) has the molecular formula C9H16BF3KNO and a molecular weight of 261.14 g/mol. Its IUPAC name is potassium 3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]prop-1-en-2-yl-trifluoroboranuide.
| Compound Name | potassium 3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]prop-1-en-2-yl-trifluoroboranuide |
|---|---|
| PubChem CID | 106746265 |
| Molecular Formula | C9H16BF3KNO |
| Molecular Weight | 261.14 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | potassium 3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]prop-1-en-2-yl-trifluoroboranuide |
| SMILES | C=C(CN1C[C@@H](C)O[C@@H](C)C1)[B-](F)(F)F.[K+] |
| InChI | InChI=1S/C9H16BF3NO.K/c1-7(10(11,12)13)4-14-5-8(2)15-9(3)6-14;/h8-9H,1,4-6H2,2-3H3;/q-1;+1/t8-,9+; |
| InChIKey | ODMJAOXJFZIAFT-UFIFRZAQSA-N |
| XLogP | -0.96 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.14 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|