C9H16BF3NO- — CID 106745724
3-(2,5-dimethylmorpholin-4-yl)prop-1-en-2-yl-trifluoroboranuide (PubChem CID 106745724) has the molecular formula C9H16BF3NO- and a molecular weight of 222.04 g/mol. Its IUPAC name is 3-(2,5-dimethylmorpholin-4-yl)prop-1-en-2-yl-trifluoroboranuide.
| Compound Name | 3-(2,5-dimethylmorpholin-4-yl)prop-1-en-2-yl-trifluoroboranuide |
|---|---|
| PubChem CID | 106745724 |
| Molecular Formula | C9H16BF3NO- |
| Molecular Weight | 222.04 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 3-(2,5-dimethylmorpholin-4-yl)prop-1-en-2-yl-trifluoroboranuide |
| SMILES | C=C(CN1CC(C)OCC1C)[B-](F)(F)F |
| InChI | InChI=1S/C9H16BF3NO/c1-7(10(11,12)13)4-14-5-9(3)15-6-8(14)2/h8-9H,1,4-6H2,2-3H3/q-1 |
| InChIKey | KWWFLOIAHVMHOL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.04 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|