C13H27NO2 — CID 62624456
1-(2,5-dimethylmorpholin-4-yl)-4,4-dimethylpentan-3-ol (PubChem CID 62624456) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is 1-(2,5-dimethylmorpholin-4-yl)-4,4-dimethylpentan-3-ol.
| Compound Name | 1-(2,5-dimethylmorpholin-4-yl)-4,4-dimethylpentan-3-ol |
|---|---|
| PubChem CID | 62624456 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 1-(2,5-dimethylmorpholin-4-yl)-4,4-dimethylpentan-3-ol |
| SMILES | CC1CN(CCC(O)C(C)(C)C)C(C)CO1 |
| InChI | InChI=1S/C13H27NO2/c1-10-9-16-11(2)8-14(10)7-6-12(15)13(3,4)5/h10-12,15H,6-9H2,1-5H3 |
| InChIKey | SVCCUIILCMTYEA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |