C9H18N2OS — CID 43544623
3-(2,5-dimethylmorpholin-4-yl)propanethioamide (PubChem CID 43544623) has the molecular formula C9H18N2OS and a molecular weight of 202.32 g/mol. Its IUPAC name is 3-(2,5-dimethylmorpholin-4-yl)propanethioamide.
| Compound Name | 3-(2,5-dimethylmorpholin-4-yl)propanethioamide |
|---|---|
| PubChem CID | 43544623 |
| Molecular Formula | C9H18N2OS |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 3-(2,5-dimethylmorpholin-4-yl)propanethioamide |
| SMILES | CC1CN(CCC(N)=S)C(C)CO1 |
| InChI | InChI=1S/C9H18N2OS/c1-7-6-12-8(2)5-11(7)4-3-9(10)13/h7-8H,3-6H2,1-2H3,(H2,10,13) |
| InChIKey | RJRBZVIBPNOZKD-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|