C9H16N2O — CID 45088973
3-[(2S,5S)-2,5-dimethylmorpholin-4-yl]propanenitrile (PubChem CID 45088973) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 3-[(2S,5S)-2,5-dimethylmorpholin-4-yl]propanenitrile.
| Compound Name | 3-[(2S,5S)-2,5-dimethylmorpholin-4-yl]propanenitrile |
|---|---|
| PubChem CID | 45088973 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 3-[(2S,5S)-2,5-dimethylmorpholin-4-yl]propanenitrile |
| SMILES | C[C@H]1CN(CCC#N)[C@@H](C)CO1 |
| InChI | InChI=1S/C9H16N2O/c1-8-7-12-9(2)6-11(8)5-3-4-10/h8-9H,3,5-7H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | KYDHKDVUEMTDMA-IUCAKERBSA-N |
| XLogP | 1.01 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |