C8H14N2O — CID 93044958
2-[(2S,5R)-2,5-dimethylmorpholin-4-yl]acetonitrile (PubChem CID 93044958) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is 2-[(2S,5R)-2,5-dimethylmorpholin-4-yl]acetonitrile.
| Compound Name | 2-[(2S,5R)-2,5-dimethylmorpholin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 93044958 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 2-[(2S,5R)-2,5-dimethylmorpholin-4-yl]acetonitrile |
| SMILES | C[C@@H]1CO[C@@H](C)CN1CC#N |
| InChI | InChI=1S/C8H14N2O/c1-7-6-11-8(2)5-10(7)4-3-9/h7-8H,4-6H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | PHWVEWLOZABCAS-SFYZADRCSA-N |
| XLogP | 0.62 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|