C14H21FN2O — CID 62561905
N-[2-(2,5-dimethylmorpholin-4-yl)ethyl]-4-fluoroaniline (PubChem CID 62561905) has the molecular formula C14H21FN2O and a molecular weight of 252.33 g/mol. Its IUPAC name is N-[2-(2,5-dimethylmorpholin-4-yl)ethyl]-4-fluoroaniline.
| Compound Name | N-[2-(2,5-dimethylmorpholin-4-yl)ethyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 62561905 |
| Molecular Formula | C14H21FN2O |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | N-[2-(2,5-dimethylmorpholin-4-yl)ethyl]-4-fluoroaniline |
| SMILES | CC1CN(CCNc2ccc(F)cc2)C(C)CO1 |
| InChI | InChI=1S/C14H21FN2O/c1-11-10-18-12(2)9-17(11)8-7-16-14-5-3-13(15)4-6-14/h3-6,11-12,16H,7-10H2,1-2H3 |
| InChIKey | DLLZXKJRKQMMJK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |